C19H27N2O6PS — CID 21135500
tert-butyl 7-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-thiophosphorosocarbonylheptanoate (PubChem CID 21135500) has the molecular formula C19H27N2O6PS and a molecular weight of 442.47 g/mol. Its IUPAC name is tert-butyl 7-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-thiophosphorosocarbonylheptanoate.
| Compound Name | tert-butyl 7-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-thiophosphorosocarbonylheptanoate |
|---|---|
| PubChem CID | 21135500 |
| Molecular Formula | C19H27N2O6PS |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | tert-butyl 7-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-thiophosphorosocarbonylheptanoate |
| SMILES | CC(C)(C)OC(=O)CC(CCCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)P=S |
| InChI | InChI=1S/C19H27N2O6PS/c1-19(2,3)27-17(25)12-13(18(26)28-29)6-4-5-10-20-14(22)9-11-21-15(23)7-8-16(21)24/h7-8,13H,4-6,9-12H2,1-3H3,(H,20,22) |
| InChIKey | LZTQVAAQFGDCDR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|