C15H23N3O5 — CID 154932340
tert-butyl N-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutyl]carbamate (PubChem CID 154932340) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 154932340 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | tert-butyl N-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H23N3O5/c1-15(2,3)23-14(22)17-8-4-5-11(19)16-9-10-18-12(20)6-7-13(18)21/h6-7H,4-5,8-10H2,1-3H3,(H,16,19)(H,17,22) |
| InChIKey | MXJAQUGCLZLLAY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|