C25H40N4O10 — CID 162148016
1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;tert-butyl N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 162148016) has the molecular formula C25H40N4O10 and a molecular weight of 556.61 g/mol. Its IUPAC name is 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;tert-butyl N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;tert-butyl N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 162148016 |
| Molecular Formula | C25H40N4O10 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;tert-butyl N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN1C(=O)C=CC1=O.NCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H24N2O6.C10H16N2O4/c1-15(2,3)23-14(20)16-6-8-21-10-11-22-9-7-17-12(18)4-5-13(17)19;11-3-5-15-7-8-16-6-4-12-9(13)1-2-10(12)14/h4-5H,6-11H2,1-3H3,(H,16,20);1-2H,3-8,11H2 |
| InChIKey | ZKVBDHABXZOSBE-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 176.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|