C18H33N3O7S — CID 135207378
tert-butyl N-(6-aminohexyl)carbamate;2-(2,5-dioxopyrrol-1-yl)ethyl methanesulfonate (PubChem CID 135207378) has the molecular formula C18H33N3O7S and a molecular weight of 435.54 g/mol. Its IUPAC name is tert-butyl N-(6-aminohexyl)carbamate;2-(2,5-dioxopyrrol-1-yl)ethyl methanesulfonate.
| Compound Name | tert-butyl N-(6-aminohexyl)carbamate;2-(2,5-dioxopyrrol-1-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 135207378 |
| Molecular Formula | C18H33N3O7S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl N-(6-aminohexyl)carbamate;2-(2,5-dioxopyrrol-1-yl)ethyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCN.CS(=O)(=O)OCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H24N2O2.C7H9NO5S/c1-11(2,3)15-10(14)13-9-7-5-4-6-8-12;1-14(11,12)13-5-4-8-6(9)2-3-7(8)10/h4-9,12H2,1-3H3,(H,13,14);2-3H,4-5H2,1H3 |
| InChIKey | WCGRRLXNMMSWBG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|