C11H17ClN4O4 — CID 145219096
[diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate (PubChem CID 145219096) has the molecular formula C11H17ClN4O4 and a molecular weight of 304.73 g/mol. Its IUPAC name is [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate.
| Compound Name | [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate |
|---|---|
| PubChem CID | 145219096 |
| Molecular Formula | C11H17ClN4O4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate |
| SMILES | NC(N)(Cl)OC(=O)NCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H17ClN4O4/c12-11(13,14)20-10(19)15-6-2-1-3-7-16-8(17)4-5-9(16)18/h4-5H,1-3,6-7,13-14H2,(H,15,19) |
| InChIKey | IMYQCNBTCXJVFC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|