About [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate
[diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate (PubChem CID 145219096) has the molecular formula C11H17ClN4O4
and a molecular weight of 304.73 g/mol. Its IUPAC name is [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate.
Molecular Properties
| Compound Name | [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate |
| PubChem CID | 145219096 |
| Molecular Formula | C11H17ClN4O4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate |
| SMILES | NC(N)(Cl)OC(=O)NCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H17ClN4O4/c12-11(13,14)20-10(19)15-6-2-1-3-7-16-8(17)4-5-9(16)18/h4-5H,1-3,6-7,13-14H2,(H,15,19) |
| InChIKey | IMYQCNBTCXJVFC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate?
The IUPAC name of [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate (CID 145219096) is [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate.
What is the SMILES notation for [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate?
The canonical SMILES for [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate is NC(N)(Cl)OC(=O)NCCCCCN1C(=O)C=CC1=O.
What is the InChIKey of [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate?
The InChIKey is IMYQCNBTCXJVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN4O4/c12-11(13,14)20-10(19)15-6-2-1-3-7-16-8(17)4-5-9(16)18/h4-5H,1-3,6-7,13-14H2,(H,15,19).
What are the key properties of [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate?
[diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate has a molecular weight of 304.73 g/mol, XLogP of -0.42, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [diamino(chloro)methyl] N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate is sourced from PubChem (CID 145219096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).