C10H15Cl2N3O4P+ — CID 139293013
amino-dichloro-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]phosphanium (PubChem CID 139293013) has the molecular formula C10H15Cl2N3O4P+ and a molecular weight of 343.13 g/mol. Its IUPAC name is amino-dichloro-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]phosphanium.
| Compound Name | amino-dichloro-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]phosphanium |
|---|---|
| PubChem CID | 139293013 |
| Molecular Formula | C10H15Cl2N3O4P+ |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | amino-dichloro-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]phosphanium |
| SMILES | N[P+](Cl)(Cl)OC(=O)NCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14Cl2N3O4P/c11-20(12,13)19-10(18)14-6-2-1-3-7-15-8(16)4-5-9(15)17/h4-5H,1-3,6-7,13H2/p+1 |
| InChIKey | NEEIUVQFOQGPKG-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|