C12H18ClN3O6P+ — CID 134402316
acetyloxy-amino-chloro-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]phosphanium (PubChem CID 134402316) has the molecular formula C12H18ClN3O6P+ and a molecular weight of 366.72 g/mol. Its IUPAC name is acetyloxy-amino-chloro-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]phosphanium.
| Compound Name | acetyloxy-amino-chloro-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]phosphanium |
|---|---|
| PubChem CID | 134402316 |
| Molecular Formula | C12H18ClN3O6P+ |
| Molecular Weight | 366.72 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | acetyloxy-amino-chloro-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]phosphanium |
| SMILES | CC(=O)O[P+](N)(Cl)OC(=O)NCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17ClN3O6P/c1-9(17)21-23(13,14)22-12(20)15-7-3-2-4-8-16-10(18)5-6-11(16)19/h5-6H,2-4,7-8,14H2,1H3/p+1 |
| InChIKey | AAROVAATRWEMHZ-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.72 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|