C22H33N5O8 — CID 170745460
[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]propanoylamino]propanoylamino]propanoylamino]methyl acetate (PubChem CID 170745460) has the molecular formula C22H33N5O8 and a molecular weight of 495.53 g/mol. Its IUPAC name is [2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]propanoylamino]propanoylamino]propanoylamino]methyl acetate.
| Compound Name | [2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]propanoylamino]propanoylamino]propanoylamino]methyl acetate |
|---|---|
| PubChem CID | 170745460 |
| Molecular Formula | C22H33N5O8 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | [2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]propanoylamino]propanoylamino]propanoylamino]methyl acetate |
| SMILES | CC(=O)OCNC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H33N5O8/c1-13(20(32)23-12-35-16(4)28)25-22(34)15(3)26-21(33)14(2)24-17(29)8-6-5-7-11-27-18(30)9-10-19(27)31/h9-10,13-15H,5-8,11-12H2,1-4H3,(H,23,32)(H,24,29)(H,25,34)(H,26,33) |
| InChIKey | IYVPIJBNRQAYQE-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 180.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|