C18H28N4O6 — CID 175412635
2-[2-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]hexanoylamino]propanoylamino]propanoic acid (PubChem CID 175412635) has the molecular formula C18H28N4O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[2-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]hexanoylamino]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]hexanoylamino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 175412635 |
| Molecular Formula | C18H28N4O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[2-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]hexanoylamino]propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)C(C)NC(=O)CCCCCNCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C18H28N4O6/c1-12(17(26)21-13(2)18(27)28)20-14(23)6-4-3-5-9-19-10-11-22-15(24)7-8-16(22)25/h7-8,12-13,19H,3-6,9-11H2,1-2H3,(H,20,23)(H,21,26)(H,27,28) |
| InChIKey | MHVZIZHMDZIOBI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|