C16H26N2O5 — CID 169179798
6-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutan-2-yl)hexanamide;formic acid (PubChem CID 169179798) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutan-2-yl)hexanamide;formic acid.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutan-2-yl)hexanamide;formic acid |
|---|---|
| PubChem CID | 169179798 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutan-2-yl)hexanamide;formic acid |
| SMILES | CC(C)C(C)NC(=O)CCCCCN1C(=O)C=CC1=O.O=CO |
| InChI | InChI=1S/C15H24N2O3.CH2O2/c1-11(2)12(3)16-13(18)7-5-4-6-10-17-14(19)8-9-15(17)20;2-1-3/h8-9,11-12H,4-7,10H2,1-3H3,(H,16,18);1H,(H,2,3) |
| InChIKey | OHQMJEOKKDAEDC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|