C20H30N2O5 — CID 158525900
N-(4,4-dimethyl-3-oxopentan-2-yl)-9-(2,5-dioxopyrrol-1-yl)-4-oxononanamide (PubChem CID 158525900) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-(4,4-dimethyl-3-oxopentan-2-yl)-9-(2,5-dioxopyrrol-1-yl)-4-oxononanamide.
| Compound Name | N-(4,4-dimethyl-3-oxopentan-2-yl)-9-(2,5-dioxopyrrol-1-yl)-4-oxononanamide |
|---|---|
| PubChem CID | 158525900 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-(4,4-dimethyl-3-oxopentan-2-yl)-9-(2,5-dioxopyrrol-1-yl)-4-oxononanamide |
| SMILES | CC(NC(=O)CCC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C20H30N2O5/c1-14(19(27)20(2,3)4)21-16(24)10-9-15(23)8-6-5-7-13-22-17(25)11-12-18(22)26/h11-12,14H,5-10,13H2,1-4H3,(H,21,24) |
| InChIKey | SRHGFFXYSAKYSL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|