C23H38N4O5 — CID 155014287
N-[1-[(8-amino-2,2-dimethyl-3-oxooctan-4-yl)amino]-1-oxopropan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 155014287) has the molecular formula C23H38N4O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[1-[(8-amino-2,2-dimethyl-3-oxooctan-4-yl)amino]-1-oxopropan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[1-[(8-amino-2,2-dimethyl-3-oxooctan-4-yl)amino]-1-oxopropan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 155014287 |
| Molecular Formula | C23H38N4O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | N-[1-[(8-amino-2,2-dimethyl-3-oxooctan-4-yl)amino]-1-oxopropan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)NC(CCCCN)C(=O)C(C)(C)C |
| InChI | InChI=1S/C23H38N4O5/c1-16(22(32)26-17(10-7-8-14-24)21(31)23(2,3)4)25-18(28)11-6-5-9-15-27-19(29)12-13-20(27)30/h12-13,16-17H,5-11,14-15,24H2,1-4H3,(H,25,28)(H,26,32) |
| InChIKey | FQIOJTDLHUTWRZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|