C24H39N5O7 — CID 155302718
N-[(2S)-1-[[(4S)-1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]amino]-4-hydroxy-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 155302718) has the molecular formula C24H39N5O7 and a molecular weight of 509.60 g/mol. Its IUPAC name is N-[(2S)-1-[[(4S)-1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]amino]-4-hydroxy-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[(2S)-1-[[(4S)-1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]amino]-4-hydroxy-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 155302718 |
| Molecular Formula | C24H39N5O7 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | N-[(2S)-1-[[(4S)-1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]amino]-4-hydroxy-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CC(C)(C)C(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](CCO)NC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H39N5O7/c1-24(2,3)21(34)16(8-7-13-26-23(25)36)28-22(35)17(12-15-30)27-18(31)9-5-4-6-14-29-19(32)10-11-20(29)33/h10-11,16-17,30H,4-9,12-15H2,1-3H3,(H,27,31)(H,28,35)(H3,25,26,36)/t16-,17-/m0/s1 |
| InChIKey | LPLZYYOXMGMOTN-IRXDYDNUSA-N |
| XLogP | -0.11 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|