C23H35N5O8 — CID 146181329
4-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid (PubChem CID 146181329) has the molecular formula C23H35N5O8 and a molecular weight of 509.56 g/mol. Its IUPAC name is 4-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 146181329 |
| Molecular Formula | C23H35N5O8 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 4-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid |
| SMILES | CC(C)C(=O)[C@H](CCCNC(N)=O)NC(=O)C(CC(=O)O)NC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H35N5O8/c1-14(2)21(34)15(7-6-11-25-23(24)36)27-22(35)16(13-20(32)33)26-17(29)8-4-3-5-12-28-18(30)9-10-19(28)31/h9-10,14-16H,3-8,11-13H2,1-2H3,(H,26,29)(H,27,35)(H,32,33)(H3,24,25,36)/t15-,16?/m0/s1 |
| InChIKey | KEDLSNQYTVIHHP-VYRBHSGPSA-N |
| XLogP | -0.41 |
| TPSA | 205.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|