C18H25N3O7 — CID 155245358
(4S)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-5-[[(2S)-4-methyl-3-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 155245358) has the molecular formula C18H25N3O7 and a molecular weight of 395.41 g/mol. Its IUPAC name is (4S)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-5-[[(2S)-4-methyl-3-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-5-[[(2S)-4-methyl-3-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 155245358 |
| Molecular Formula | C18H25N3O7 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (4S)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-5-[[(2S)-4-methyl-3-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H25N3O7/c1-10(2)17(27)11(3)19-18(28)12(4-7-16(25)26)20-13(22)8-9-21-14(23)5-6-15(21)24/h5-6,10-12H,4,7-9H2,1-3H3,(H,19,28)(H,20,22)(H,25,26)/t11-,12-/m0/s1 |
| InChIKey | QGZCNBLDPYQNFU-RYUDHWBXSA-N |
| XLogP | -0.62 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|