C16H22N4O8 — CID 137489718
(2R)-2-[[(2R)-2-amino-5-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-5-oxopentanoyl]amino]pentanedioic acid (PubChem CID 137489718) has the molecular formula C16H22N4O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-amino-5-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-5-oxopentanoyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[(2R)-2-amino-5-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-5-oxopentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 137489718 |
| Molecular Formula | C16H22N4O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (2R)-2-[[(2R)-2-amino-5-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-5-oxopentanoyl]amino]pentanedioic acid |
| SMILES | N[C@H](CCC(=O)NCCN1C(=O)C=CC1=O)C(=O)N[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H22N4O8/c17-9(15(26)19-10(16(27)28)2-6-14(24)25)1-3-11(21)18-7-8-20-12(22)4-5-13(20)23/h4-5,9-10H,1-3,6-8,17H2,(H,18,21)(H,19,26)(H,24,25)(H,27,28)/t9-,10-/m1/s1 |
| InChIKey | LQCRPIUZYCMENX-NXEZZACHSA-N |
| XLogP | -2.43 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|