C22H28N4O8 — CID 149461686
(2S)-2,6-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid (PubChem CID 149461686) has the molecular formula C22H28N4O8 and a molecular weight of 476.49 g/mol. Its IUPAC name is (2S)-2,6-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid.
| Compound Name | (2S)-2,6-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 149461686 |
| Molecular Formula | C22H28N4O8 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (2S)-2,6-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid |
| SMILES | O=C(CCCN1C(=O)C=CC1=O)NCCCC[C@H](NC(=O)CCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C22H28N4O8/c27-16(6-3-13-25-18(29)8-9-19(25)30)23-12-2-1-5-15(22(33)34)24-17(28)7-4-14-26-20(31)10-11-21(26)32/h8-11,15H,1-7,12-14H2,(H,23,27)(H,24,28)(H,33,34)/t15-/m0/s1 |
| InChIKey | YZQDXCDROPSBHL-HNNXBMFYSA-N |
| XLogP | -0.75 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|