C22H36N2O10 — CID 155286869
6-(2,5-dioxopyrrol-1-yl)-2-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid (PubChem CID 155286869) has the molecular formula C22H36N2O10 and a molecular weight of 488.53 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-2-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-2-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 155286869 |
| Molecular Formula | C22H36N2O10 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-2-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid |
| SMILES | COCCOCCOCCOCCOCCC(=O)NC(CCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C22H36N2O10/c1-30-10-11-32-14-15-34-17-16-33-13-12-31-9-7-19(25)23-18(22(28)29)4-2-3-8-24-20(26)5-6-21(24)27/h5-6,18H,2-4,7-17H2,1H3,(H,23,25)(H,28,29) |
| InChIKey | UFXSYANLQIWYJM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 149.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|