C13H17N5O5 — CID 156694813
(2S)-6-azido-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid (PubChem CID 156694813) has the molecular formula C13H17N5O5 and a molecular weight of 323.31 g/mol. Its IUPAC name is (2S)-6-azido-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid.
| Compound Name | (2S)-6-azido-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 156694813 |
| Molecular Formula | C13H17N5O5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2S)-6-azido-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid |
| SMILES | [N-]=[N+]=NCCCC[C@H](NC(=O)CCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C13H17N5O5/c14-17-15-7-2-1-3-9(13(22)23)16-10(19)6-8-18-11(20)4-5-12(18)21/h4-5,9H,1-3,6-8H2,(H,16,19)(H,22,23)/t9-/m0/s1 |
| InChIKey | UQVSZBJUNPWWRV-VIFPVBQESA-N |
| XLogP | 0.35 |
| TPSA | 152.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|