C12H17N3O5 — CID 176610853
6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid (PubChem CID 176610853) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 176610853 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C12H17N3O5/c13-6-2-1-3-8(12(19)20)14-9(16)7-15-10(17)4-5-11(15)18/h4-5,8H,1-3,6-7,13H2,(H,14,16)(H,19,20) |
| InChIKey | MGDYOZAURNOGKO-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|