C13H20N4O5 — CID 100941832
(2R)-6-amino-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid (PubChem CID 100941832) has the molecular formula C13H20N4O5 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2R)-6-amino-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid.
| Compound Name | (2R)-6-amino-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 100941832 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2R)-6-amino-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid |
| SMILES | Cc1cn(CC(=O)N[C@H](CCCCN)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H20N4O5/c1-8-6-17(13(22)16-11(8)19)7-10(18)15-9(12(20)21)4-2-3-5-14/h6,9H,2-5,7,14H2,1H3,(H,15,18)(H,20,21)(H,16,19,22)/t9-/m1/s1 |
| InChIKey | UQLGXLMGKNBZDH-SECBINFHSA-N |
| XLogP | -1.46 |
| TPSA | 147.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|