C17H27N5O7 — CID 10716659
(2S)-5-(carbamoylamino)-2-[5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentoxycarbonylamino]pentanoic acid (PubChem CID 10716659) has the molecular formula C17H27N5O7 and a molecular weight of 413.43 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentoxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 10716659 |
| Molecular Formula | C17H27N5O7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentoxycarbonylamino]pentanoic acid |
| SMILES | Cc1cn(CCCCCOC(=O)N[C@@H](CCCNC(N)=O)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H27N5O7/c1-11-10-22(16(27)21-13(11)23)8-3-2-4-9-29-17(28)20-12(14(24)25)6-5-7-19-15(18)26/h10,12H,2-9H2,1H3,(H,20,28)(H,24,25)(H3,18,19,26)(H,21,23,27)/t12-/m0/s1 |
| InChIKey | DYWFHRCBQCBQJQ-LBPRGKRZSA-N |
| XLogP | -0.36 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|