C35H37N3O6 — CID 101017481
6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate (PubChem CID 101017481) has the molecular formula C35H37N3O6 and a molecular weight of 595.70 g/mol. Its IUPAC name is 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate.
| Compound Name | 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 101017481 |
| Molecular Formula | C35H37N3O6 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
| SMILES | Cc1cn(CCCCCCOC(=O)[C@H](Cc2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C35H37N3O6/c1-24-22-38(34(41)37-32(24)39)19-11-2-3-12-20-43-33(40)31(21-25-13-5-4-6-14-25)36-35(42)44-23-30-28-17-9-7-15-26(28)27-16-8-10-18-29(27)30/h4-10,13-18,22,30-31H,2-3,11-12,19-21,23H2,1H3,(H,36,42)(H,37,39,41)/t31-/m0/s1 |
| InChIKey | YABHCXXJBJNHCM-HKBQPEDESA-N |
| XLogP | 5.10 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|