C27H29NO3 — CID 172641438
ethane;9H-fluoren-9-ylmethyl N-(3-oxo-1-phenylbutan-2-yl)carbamate (PubChem CID 172641438) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is ethane;9H-fluoren-9-ylmethyl N-(3-oxo-1-phenylbutan-2-yl)carbamate.
| Compound Name | ethane;9H-fluoren-9-ylmethyl N-(3-oxo-1-phenylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 172641438 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | ethane;9H-fluoren-9-ylmethyl N-(3-oxo-1-phenylbutan-2-yl)carbamate |
| SMILES | CC.CC(=O)C(Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H23NO3.C2H6/c1-17(27)24(15-18-9-3-2-4-10-18)26-25(28)29-16-23-21-13-7-5-11-19(21)20-12-6-8-14-22(20)23;1-2/h2-14,23-24H,15-16H2,1H3,(H,26,28);1-2H3 |
| InChIKey | NIOSKICYILFQRJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |