C34H31NO5 — CID 58061618
2-benzyl-5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-6-phenylhexanoic acid (PubChem CID 58061618) has the molecular formula C34H31NO5 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-benzyl-5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-6-phenylhexanoic acid.
| Compound Name | 2-benzyl-5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 58061618 |
| Molecular Formula | C34H31NO5 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-benzyl-5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-6-phenylhexanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)CC(Cc1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H31NO5/c36-32(21-25(33(37)38)19-23-11-3-1-4-12-23)31(20-24-13-5-2-6-14-24)35-34(39)40-22-30-28-17-9-7-15-26(28)27-16-8-10-18-29(27)30/h1-18,25,30-31H,19-22H2,(H,35,39)(H,37,38) |
| InChIKey | LTRQNXBKUKMEBE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |