C54H50N2O8 — CID 102292712
[(E)-6-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]oxyhex-3-enyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate (PubChem CID 102292712) has the molecular formula C54H50N2O8 and a molecular weight of 855.00 g/mol. Its IUPAC name is [(E)-6-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]oxyhex-3-enyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate.
| Compound Name | [(E)-6-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]oxyhex-3-enyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 102292712 |
| Molecular Formula | C54H50N2O8 |
| Molecular Weight | 855.00 g/mol |
| Exact Mass | 854.36 |
| IUPAC Name | [(E)-6-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]oxyhex-3-enyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)OCC/C=C/CCOC(=O)[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C54H50N2O8/c57-51(49(33-37-19-5-3-6-20-37)55-53(59)63-35-47-43-27-13-9-23-39(43)40-24-10-14-28-44(40)47)61-31-17-1-2-18-32-62-52(58)50(34-38-21-7-4-8-22-38)56-54(60)64-36-48-45-29-15-11-25-41(45)42-26-12-16-30-46(42)48/h1-16,19-30,47-50H,17-18,31-36H2,(H,55,59)(H,56,60)/b2-1+/t49-,50-/m0/s1 |
| InChIKey | JYEQSEOWCUACRA-OQJZLOBCSA-N |
| XLogP | 9.71 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.00 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|