C32H29N3O4 — CID 44890403
[(E)-[amino-(4-methylphenyl)methylidene]amino] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate (PubChem CID 44890403) has the molecular formula C32H29N3O4 and a molecular weight of 519.60 g/mol. Its IUPAC name is [(E)-[amino-(4-methylphenyl)methylidene]amino] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate.
| Compound Name | [(E)-[amino-(4-methylphenyl)methylidene]amino] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 44890403 |
| Molecular Formula | C32H29N3O4 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | [(E)-[amino-(4-methylphenyl)methylidene]amino] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
| SMILES | Cc1ccc(/C(N)=N\OC(=O)[C@H](Cc2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C32H29N3O4/c1-21-15-17-23(18-16-21)30(33)35-39-31(36)29(19-22-9-3-2-4-10-22)34-32(37)38-20-28-26-13-7-5-11-24(26)25-12-6-8-14-27(25)28/h2-18,28-29H,19-20H2,1H3,(H2,33,35)(H,34,37)/t29-/m0/s1 |
| InChIKey | FOMXSAIEGDWMNQ-LJAQVGFWSA-N |
| XLogP | 5.31 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|