C14H16N4O4 — CID 90302912
(2S)-6-azido-2-[(4-formylbenzoyl)amino]hexanoic acid (PubChem CID 90302912) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is (2S)-6-azido-2-[(4-formylbenzoyl)amino]hexanoic acid.
| Compound Name | (2S)-6-azido-2-[(4-formylbenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 90302912 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (2S)-6-azido-2-[(4-formylbenzoyl)amino]hexanoic acid |
| SMILES | [N-]=[N+]=NCCCC[C@H](NC(=O)c1ccc(C=O)cc1)C(=O)O |
| InChI | InChI=1S/C14H16N4O4/c15-18-16-8-2-1-3-12(14(21)22)17-13(20)11-6-4-10(9-19)5-7-11/h4-7,9,12H,1-3,8H2,(H,17,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | ZNMRIVYHJOVHRD-LBPRGKRZSA-N |
| XLogP | 2.16 |
| TPSA | 132.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|