C32H30N6O4 — CID 14503337
(2S)-2,6-bis[(4-phenyldiazenylbenzoyl)amino]hexanoic acid (PubChem CID 14503337) has the molecular formula C32H30N6O4 and a molecular weight of 562.63 g/mol. Its IUPAC name is (2S)-2,6-bis[(4-phenyldiazenylbenzoyl)amino]hexanoic acid.
| Compound Name | (2S)-2,6-bis[(4-phenyldiazenylbenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 14503337 |
| Molecular Formula | C32H30N6O4 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (2S)-2,6-bis[(4-phenyldiazenylbenzoyl)amino]hexanoic acid |
| SMILES | O=C(NCCCC[C@H](NC(=O)c1ccc(/N=N/c2ccccc2)cc1)C(=O)O)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N6O4/c39-30(23-14-18-27(19-15-23)37-35-25-9-3-1-4-10-25)33-22-8-7-13-29(32(41)42)34-31(40)24-16-20-28(21-17-24)38-36-26-11-5-2-6-12-26/h1-6,9-12,14-21,29H,7-8,13,22H2,(H,33,39)(H,34,40)(H,41,42)/b37-35+,38-36+/t29-/m0/s1 |
| InChIKey | GCBQTJJZFQKPHL-BFJNGMTQSA-N |
| XLogP | 7.30 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|