C19H24N6O8 — CID 122616990
2-[[(1S)-5-[(4-azidobenzoyl)amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 122616990) has the molecular formula C19H24N6O8 and a molecular weight of 464.44 g/mol. Its IUPAC name is 2-[[(1S)-5-[(4-azidobenzoyl)amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[(1S)-5-[(4-azidobenzoyl)amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 122616990 |
| Molecular Formula | C19H24N6O8 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-[[(1S)-5-[(4-azidobenzoyl)amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)NCCCC[C@H](NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C19H24N6O8/c20-25-24-12-6-4-11(5-7-12)16(28)21-10-2-1-3-13(17(29)30)22-19(33)23-14(18(31)32)8-9-15(26)27/h4-7,13-14H,1-3,8-10H2,(H,21,28)(H,26,27)(H,29,30)(H,31,32)(H2,22,23,33)/t13-,14?/m0/s1 |
| InChIKey | GFUSHIXPRCLJSN-LSLKUGRBSA-N |
| XLogP | 1.60 |
| TPSA | 230.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|