C19H25N4O8+ — CID 90695532
CID 90695532 (PubChem CID 90695532) has the molecular formula C19H25N4O8+ and a molecular weight of 437.43 g/mol.
| Compound Name | CID 90695532 |
|---|---|
| PubChem CID | 90695532 |
| Molecular Formula | C19H25N4O8+ |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | — |
| SMILES | [CH2+]c1ccc(C(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)cn1 |
| InChI | InChI=1S/C19H24N4O8/c1-11-5-6-12(10-21-11)16(26)20-9-3-2-4-13(17(27)28)22-19(31)23-14(18(29)30)7-8-15(24)25/h5-6,10,13-14H,1-4,7-9H2,(H5-,20,22,23,24,25,26,27,28,29,30,31)/p+1 |
| InChIKey | ISCCDOKTCAIYOT-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|