C37H55N7O15 — CID 153294140
2-[[1-carboxy-5-[[4-[3-oxo-4-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butyl]benzoyl]amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 153294140) has the molecular formula C37H55N7O15 and a molecular weight of 837.88 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[[4-[3-oxo-4-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butyl]benzoyl]amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[[4-[3-oxo-4-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butyl]benzoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 153294140 |
| Molecular Formula | C37H55N7O15 |
| Molecular Weight | 837.88 g/mol |
| Exact Mass | 837.38 |
| IUPAC Name | 2-[[1-carboxy-5-[[4-[3-oxo-4-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butyl]benzoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NC(CCCCNC(=O)c1ccc(CCC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C37H55N7O15/c45-27(21-41-13-15-42(22-31(48)49)17-19-44(24-33(52)53)20-18-43(16-14-41)23-32(50)51)9-6-25-4-7-26(8-5-25)34(54)38-12-2-1-3-28(35(55)56)39-37(59)40-29(36(57)58)10-11-30(46)47/h4-5,7-8,28-29H,1-3,6,9-24H2,(H,38,54)(H,46,47)(H,48,49)(H,50,51)(H,52,53)(H,55,56)(H,57,58)(H2,39,40,59) |
| InChIKey | AEPHFDIUBJIOQQ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 324.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.88 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|