C42H74N8O14 — CID 123981693
(2S)-2-[[(1S)-5-[[8-[[9-[4,7-bis(carboxymethyl)-10-methyl-1,4,7,10-tetrazacyclododec-1-yl]-8-oxononyl]amino]-8-oxooctanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 123981693) has the molecular formula C42H74N8O14 and a molecular weight of 915.10 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[[8-[[9-[4,7-bis(carboxymethyl)-10-methyl-1,4,7,10-tetrazacyclododec-1-yl]-8-oxononyl]amino]-8-oxooctanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[[8-[[9-[4,7-bis(carboxymethyl)-10-methyl-1,4,7,10-tetrazacyclododec-1-yl]-8-oxononyl]amino]-8-oxooctanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 123981693 |
| Molecular Formula | C42H74N8O14 |
| Molecular Weight | 915.10 g/mol |
| Exact Mass | 914.53 |
| IUPAC Name | (2S)-2-[[(1S)-5-[[8-[[9-[4,7-bis(carboxymethyl)-10-methyl-1,4,7,10-tetrazacyclododec-1-yl]-8-oxononyl]amino]-8-oxooctanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)CCCCCCCNC(=O)CCCCCCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C42H74N8O14/c1-47-21-23-48(25-26-50(31-39(58)59)28-27-49(24-22-47)30-38(56)57)29-32(51)13-7-3-2-6-11-19-43-35(52)15-8-4-5-9-16-36(53)44-20-12-10-14-33(40(60)61)45-42(64)46-34(41(62)63)17-18-37(54)55/h33-34H,2-31H2,1H3,(H,43,52)(H,44,53)(H,54,55)(H,56,57)(H,58,59)(H,60,61)(H,62,63)(H2,45,46,64)/t33-,34-/m0/s1 |
| InChIKey | LXLRWUIEYMGMFU-HEVIKAOCSA-N |
| XLogP | 0.73 |
| TPSA | 315.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.10 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|