C19H24FN3O8 — CID 67178458
2-[[5-carboxy-5-[(4-fluorobenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 67178458) has the molecular formula C19H24FN3O8 and a molecular weight of 441.41 g/mol. Its IUPAC name is 2-[[5-carboxy-5-[(4-fluorobenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[5-carboxy-5-[(4-fluorobenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 67178458 |
| Molecular Formula | C19H24FN3O8 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[[5-carboxy-5-[(4-fluorobenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NCCCCC(NC(=O)c1ccc(F)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H24FN3O8/c20-12-6-4-11(5-7-12)16(26)22-13(17(27)28)3-1-2-10-21-19(31)23-14(18(29)30)8-9-15(24)25/h4-7,13-14H,1-3,8-10H2,(H,22,26)(H,24,25)(H,27,28)(H,29,30)(H2,21,23,31) |
| InChIKey | KSKACFUSUYVUFW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|