C19H24FN3O9 — CID 89414826
(2S)-2-[[(1S)-1-carboxy-5-[(4-fluorobenzoyl)amino]pentyl]carbamoyl-hydroxyamino]pentanedioic acid (PubChem CID 89414826) has the molecular formula C19H24FN3O9 and a molecular weight of 457.41 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[(4-fluorobenzoyl)amino]pentyl]carbamoyl-hydroxyamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[(4-fluorobenzoyl)amino]pentyl]carbamoyl-hydroxyamino]pentanedioic acid |
|---|---|
| PubChem CID | 89414826 |
| Molecular Formula | C19H24FN3O9 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[(4-fluorobenzoyl)amino]pentyl]carbamoyl-hydroxyamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](C(=O)O)N(O)C(=O)N[C@@H](CCCCNC(=O)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C19H24FN3O9/c20-12-6-4-11(5-7-12)16(26)21-10-2-1-3-13(17(27)28)22-19(31)23(32)14(18(29)30)8-9-15(24)25/h4-7,13-14,32H,1-3,8-10H2,(H,21,26)(H,22,31)(H,24,25)(H,27,28)(H,29,30)/t13-,14-/m0/s1 |
| InChIKey | QHJDZPFWAZGFJL-KBPBESRZSA-N |
| XLogP | 0.90 |
| TPSA | 193.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|