C19H25N3O8 — CID 89418097
(2S)-2-[[2-[5-benzamidopentanoyl(hydroxy)amino]acetyl]amino]pentanedioic acid (PubChem CID 89418097) has the molecular formula C19H25N3O8 and a molecular weight of 423.42 g/mol. Its IUPAC name is (2S)-2-[[2-[5-benzamidopentanoyl(hydroxy)amino]acetyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[2-[5-benzamidopentanoyl(hydroxy)amino]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 89418097 |
| Molecular Formula | C19H25N3O8 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (2S)-2-[[2-[5-benzamidopentanoyl(hydroxy)amino]acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)CN(O)C(=O)CCCCNC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H25N3O8/c23-15(21-14(19(28)29)9-10-17(25)26)12-22(30)16(24)8-4-5-11-20-18(27)13-6-2-1-3-7-13/h1-3,6-7,14,30H,4-5,8-12H2,(H,20,27)(H,21,23)(H,25,26)(H,28,29)/t14-/m0/s1 |
| InChIKey | KSDCOANBYXDXST-AWEZNQCLSA-N |
| XLogP | 0.24 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|