C19H28N2O6S — CID 108731627
2-(6-benzamidohexanoylamino)-4-ethylsulfonylbutanoic acid (PubChem CID 108731627) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-(6-benzamidohexanoylamino)-4-ethylsulfonylbutanoic acid.
| Compound Name | 2-(6-benzamidohexanoylamino)-4-ethylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 108731627 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-(6-benzamidohexanoylamino)-4-ethylsulfonylbutanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)CCCCCNC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H28N2O6S/c1-2-28(26,27)14-12-16(19(24)25)21-17(22)11-7-4-8-13-20-18(23)15-9-5-3-6-10-15/h3,5-6,9-10,16H,2,4,7-8,11-14H2,1H3,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | RWNABEYQPPPZOC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|