C16H19NO6 — CID 108796206
2-[(5-oxo-5-phenylpentanoyl)amino]pentanedioic acid (PubChem CID 108796206) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-[(5-oxo-5-phenylpentanoyl)amino]pentanedioic acid.
| Compound Name | 2-[(5-oxo-5-phenylpentanoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 108796206 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[(5-oxo-5-phenylpentanoyl)amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)CCCC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H19NO6/c18-13(11-5-2-1-3-6-11)7-4-8-14(19)17-12(16(22)23)9-10-15(20)21/h1-3,5-6,12H,4,7-10H2,(H,17,19)(H,20,21)(H,22,23) |
| InChIKey | CKIYXSVNIQLLDM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |