C13H12F3NO4 — CID 14390809
5-oxo-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid (PubChem CID 14390809) has the molecular formula C13H12F3NO4 and a molecular weight of 303.24 g/mol. Its IUPAC name is 5-oxo-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid.
| Compound Name | 5-oxo-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 14390809 |
| Molecular Formula | C13H12F3NO4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 5-oxo-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid |
| SMILES | O=C(CCC(NC(=O)C(F)(F)F)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H12F3NO4/c14-13(15,16)12(21)17-9(11(19)20)6-7-10(18)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,17,21)(H,19,20) |
| InChIKey | LNNMTDBQCPMXBG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |