C14H19N3O4 — CID 62487551
5-amino-2-[(2-amino-2-phenylpropanoyl)amino]-5-oxopentanoic acid (PubChem CID 62487551) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 5-amino-2-[(2-amino-2-phenylpropanoyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(2-amino-2-phenylpropanoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62487551 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-amino-2-[(2-amino-2-phenylpropanoyl)amino]-5-oxopentanoic acid |
| SMILES | CC(N)(C(=O)NC(CCC(N)=O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H19N3O4/c1-14(16,9-5-3-2-4-6-9)13(21)17-10(12(19)20)7-8-11(15)18/h2-6,10H,7-8,16H2,1H3,(H2,15,18)(H,17,21)(H,19,20) |
| InChIKey | VNKBIWSIGMTIKF-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |