C16H19N3O6 — CID 174866126
5-amino-2-[[2-(diformylamino)-2-phenylpropanoyl]amino]-5-oxopentanoic acid (PubChem CID 174866126) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is 5-amino-2-[[2-(diformylamino)-2-phenylpropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-(diformylamino)-2-phenylpropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174866126 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 5-amino-2-[[2-(diformylamino)-2-phenylpropanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C(=O)NC(CCC(N)=O)C(=O)O)(c1ccccc1)N(C=O)C=O |
| InChI | InChI=1S/C16H19N3O6/c1-16(19(9-20)10-21,11-5-3-2-4-6-11)15(25)18-12(14(23)24)7-8-13(17)22/h2-6,9-10,12H,7-8H2,1H3,(H2,17,22)(H,18,25)(H,23,24) |
| InChIKey | ZMUOMBLXFKUINP-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|