C13H14F3NO4 — CID 25323944
(2S,5R)-2-benzamido-6,6,6-trifluoro-5-hydroxyhexanoic acid (PubChem CID 25323944) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is (2S,5R)-2-benzamido-6,6,6-trifluoro-5-hydroxyhexanoic acid.
| Compound Name | (2S,5R)-2-benzamido-6,6,6-trifluoro-5-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 25323944 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2S,5R)-2-benzamido-6,6,6-trifluoro-5-hydroxyhexanoic acid |
| SMILES | O=C(N[C@@H](CC[C@@H](O)C(F)(F)F)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H14F3NO4/c14-13(15,16)10(18)7-6-9(12(20)21)17-11(19)8-4-2-1-3-5-8/h1-5,9-10,18H,6-7H2,(H,17,19)(H,20,21)/t9-,10+/m0/s1 |
| InChIKey | JSBGFGISEDFDKJ-VHSXEESVSA-N |
| XLogP | 1.57 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |