(2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid

C13H15F2NO4 — CID 25324625

IUPAC(2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid
SMILESO=C(N[C@@H](CC[C@@H](O)C(F)F)C(=O)O)c1ccccc1
InChIInChI=1S/C13H15F2NO4/c14-11(15)10(17)7-6-9(13(19)20)16-12(18)8-4-2-1-3-5-8/h1-5,9-11,17H,6-7H2,(H,16,18)(H,19,20)/t9-,10+/m0/s1
InChIKeyIKVLZRYMBYIKMA-VHSXEESVSA-N
MW287.26 g/mol
LogP1.28
Rot. Bonds7

About (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid

(2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid (PubChem CID 25324625) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid.

Molecular Properties

Compound Name(2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid
PubChem CID25324625
Molecular FormulaC13H15F2NO4
Molecular Weight287.26 g/mol
Exact Mass287.10
IUPAC Name(2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid
SMILESO=C(N[C@@H](CC[C@@H](O)C(F)F)C(=O)O)c1ccccc1
InChIInChI=1S/C13H15F2NO4/c14-11(15)10(17)7-6-9(13(19)20)16-12(18)8-4-2-1-3-5-8/h1-5,9-11,17H,6-7H2,(H,16,18)(H,19,20)/t9-,10+/m0/s1
InChIKeyIKVLZRYMBYIKMA-VHSXEESVSA-N
XLogP1.28
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.26
LogP ≤ 51.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid?
The IUPAC name of (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid (CID 25324625) is (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid.
What is the SMILES notation for (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid?
The canonical SMILES for (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid is O=C(N[C@@H](CC[C@@H](O)C(F)F)C(=O)O)c1ccccc1.
What is the InChIKey of (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid?
The InChIKey is IKVLZRYMBYIKMA-VHSXEESVSA-N. The full InChI is InChI=1S/C13H15F2NO4/c14-11(15)10(17)7-6-9(13(19)20)16-12(18)8-4-2-1-3-5-8/h1-5,9-11,17H,6-7H2,(H,16,18)(H,19,20)/t9-,10+/m0/s1.
What are the key properties of (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid?
(2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid has a molecular weight of 287.26 g/mol, XLogP of 1.28, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid is sourced from PubChem (CID 25324625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).