C13H15F2NO4 — CID 25324625
(2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid (PubChem CID 25324625) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid.
| Compound Name | (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 25324625 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (2S,5R)-2-benzamido-6,6-difluoro-5-hydroxyhexanoic acid |
| SMILES | O=C(N[C@@H](CC[C@@H](O)C(F)F)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H15F2NO4/c14-11(15)10(17)7-6-9(13(19)20)16-12(18)8-4-2-1-3-5-8/h1-5,9-11,17H,6-7H2,(H,16,18)(H,19,20)/t9-,10+/m0/s1 |
| InChIKey | IKVLZRYMBYIKMA-VHSXEESVSA-N |
| XLogP | 1.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |