C13H18CaN2O5 — CID 174947679
calcium;(2S)-2-benzamido-5-(methylaminooxy)-5-oxopentanoic acid;hydride (PubChem CID 174947679) has the molecular formula C13H18CaN2O5 and a molecular weight of 322.37 g/mol. Its IUPAC name is calcium;(2S)-2-benzamido-5-(methylaminooxy)-5-oxopentanoic acid;hydride.
| Compound Name | calcium;(2S)-2-benzamido-5-(methylaminooxy)-5-oxopentanoic acid;hydride |
|---|---|
| PubChem CID | 174947679 |
| Molecular Formula | C13H18CaN2O5 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | calcium;(2S)-2-benzamido-5-(methylaminooxy)-5-oxopentanoic acid;hydride |
| SMILES | CNOC(=O)CC[C@H](NC(=O)c1ccccc1)C(=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C13H16N2O5.Ca.2H/c1-14-20-11(16)8-7-10(13(18)19)15-12(17)9-5-3-2-4-6-9;;;/h2-6,10,14H,7-8H2,1H3,(H,15,17)(H,18,19);;;/q;+2;2*-1/t10-;;;/m0.../s1 |
| InChIKey | ZOYNBOHLAVTNLE-KAFJHEIMSA-N |
| XLogP | 0.17 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|