C18H27NO8 — CID 154613203
2-benzamido-4-[2-hydroxy-3-(2-hydroxy-3-methoxypropoxy)propoxy]butanoic acid (PubChem CID 154613203) has the molecular formula C18H27NO8 and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-benzamido-4-[2-hydroxy-3-(2-hydroxy-3-methoxypropoxy)propoxy]butanoic acid.
| Compound Name | 2-benzamido-4-[2-hydroxy-3-(2-hydroxy-3-methoxypropoxy)propoxy]butanoic acid |
|---|---|
| PubChem CID | 154613203 |
| Molecular Formula | C18H27NO8 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-benzamido-4-[2-hydroxy-3-(2-hydroxy-3-methoxypropoxy)propoxy]butanoic acid |
| SMILES | COCC(O)COCC(O)COCCC(NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H27NO8/c1-25-9-14(20)11-27-12-15(21)10-26-8-7-16(18(23)24)19-17(22)13-5-3-2-4-6-13/h2-6,14-16,20-21H,7-12H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | SRIKRSQSPSONRB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|