C16H10F5NO3 — CID 3511443
2-benzamido-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid (PubChem CID 3511443) has the molecular formula C16H10F5NO3 and a molecular weight of 359.25 g/mol. Its IUPAC name is 2-benzamido-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid.
| Compound Name | 2-benzamido-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 3511443 |
| Molecular Formula | C16H10F5NO3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-benzamido-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
| SMILES | O=C(NC(Cc1c(F)c(F)c(F)c(F)c1F)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H10F5NO3/c17-10-8(11(18)13(20)14(21)12(10)19)6-9(16(24)25)22-15(23)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,22,23)(H,24,25) |
| InChIKey | LGGGKWNNYJRIQM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|