C18H18FNO4 — CID 131965188
2-benzamido-3-phenylpropanoic acid;2-fluoroacetaldehyde (PubChem CID 131965188) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-benzamido-3-phenylpropanoic acid;2-fluoroacetaldehyde.
| Compound Name | 2-benzamido-3-phenylpropanoic acid;2-fluoroacetaldehyde |
|---|---|
| PubChem CID | 131965188 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-benzamido-3-phenylpropanoic acid;2-fluoroacetaldehyde |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1ccccc1.O=CCF |
| InChI | InChI=1S/C16H15NO3.C2H3FO/c18-15(13-9-5-2-6-10-13)17-14(16(19)20)11-12-7-3-1-4-8-12;3-1-2-4/h1-10,14H,11H2,(H,17,18)(H,19,20);2H,1H2 |
| InChIKey | OWVYFKRDSSNURX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|