C22H21F3N2O5 — CID 87334104
(2S)-6-[(4-benzoylbenzoyl)amino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 87334104) has the molecular formula C22H21F3N2O5 and a molecular weight of 450.41 g/mol. Its IUPAC name is (2S)-6-[(4-benzoylbenzoyl)amino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | (2S)-6-[(4-benzoylbenzoyl)amino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 87334104 |
| Molecular Formula | C22H21F3N2O5 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (2S)-6-[(4-benzoylbenzoyl)amino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | O=C(NCCCC[C@H](NC(=O)C(F)(F)F)C(=O)O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21F3N2O5/c23-22(24,25)21(32)27-17(20(30)31)8-4-5-13-26-19(29)16-11-9-15(10-12-16)18(28)14-6-2-1-3-7-14/h1-3,6-7,9-12,17H,4-5,8,13H2,(H,26,29)(H,27,32)(H,30,31)/t17-/m0/s1 |
| InChIKey | OOLGEGJJMXRGLZ-KRWDZBQOSA-N |
| XLogP | 2.95 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|