C15H21N3O4 — CID 7010495
(2S)-6-amino-2-[(2-benzamidoacetyl)amino]hexanoic acid (PubChem CID 7010495) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is (2S)-6-amino-2-[(2-benzamidoacetyl)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(2-benzamidoacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 7010495 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (2S)-6-amino-2-[(2-benzamidoacetyl)amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CNC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H21N3O4/c16-9-5-4-8-12(15(21)22)18-13(19)10-17-14(20)11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,16H2,(H,17,20)(H,18,19)(H,21,22)/t12-/m0/s1 |
| InChIKey | LRCZLURYHGISRZ-LBPRGKRZSA-N |
| XLogP | 0.11 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|