C11H16ClN3O2 — CID 119384286
N-[2-(2-aminoethylamino)-2-oxoethyl]benzamide;hydrochloride (PubChem CID 119384286) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is N-[2-(2-aminoethylamino)-2-oxoethyl]benzamide;hydrochloride.
| Compound Name | N-[2-(2-aminoethylamino)-2-oxoethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119384286 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[2-(2-aminoethylamino)-2-oxoethyl]benzamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H15N3O2.ClH/c12-6-7-13-10(15)8-14-11(16)9-4-2-1-3-5-9;/h1-5H,6-8,12H2,(H,13,15)(H,14,16);1H |
| InChIKey | XLBXOPYNHISZQZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |